C18H24N6O2 — CID 155525326
N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)-2-[(E)-1-iminobut-2-en-2-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 155525326) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)-2-[(E)-1-iminobut-2-en-2-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)-2-[(E)-1-iminobut-2-en-2-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155525326 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-(1-imidazol-1-yl-3,3-dimethylbutan-2-yl)-2-[(E)-1-iminobut-2-en-2-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | [H]/N=C/C(=C\C)c1ncc(C(=O)NC(Cn2ccnc2)C(C)(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C18H24N6O2/c1-5-12(8-19)15-21-9-13(17(26)23-15)16(25)22-14(18(2,3)4)10-24-7-6-20-11-24/h5-9,11,14,19H,10H2,1-4H3,(H,22,25)(H,21,23,26)/b12-5+,19-8+ |
| InChIKey | SYSNWVRIFFGJMH-DBPFEVDHSA-N |
| XLogP | 1.86 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|