C15H19BrFN7O5S — CID 155525338
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-hydroxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155525338) has the molecular formula C15H19BrFN7O5S and a molecular weight of 508.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-hydroxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-hydroxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155525338 |
| Molecular Formula | C15H19BrFN7O5S |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-(2-hydroxyethyl)-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S1(=O)N(CCO)CCN1CCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C15H19BrFN7O5S/c16-11-9-10(1-2-12(11)17)19-15(20-26)13-14(22-29-21-13)18-3-4-23-5-6-24(7-8-25)30(23,27)28/h1-2,9,25-26H,3-8H2,(H,18,22)(H,19,20) |
| InChIKey | XICLIDUMPNNCAD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|