C15H24N2O3 — CID 155525341
2-aminoethanol;6-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-1-hydroxy-4-methylpyridin-2-one (PubChem CID 155525341) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-aminoethanol;6-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-1-hydroxy-4-methylpyridin-2-one.
| Compound Name | 2-aminoethanol;6-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-1-hydroxy-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 155525341 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-aminoethanol;6-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-1-hydroxy-4-methylpyridin-2-one |
| SMILES | Cc1cc([C@@H]2C[C@@H]3CC[C@H]2C3)n(O)c(=O)c1.NCCO |
| InChI | InChI=1S/C13H17NO2.C2H7NO/c1-8-4-12(14(16)13(15)5-8)11-7-9-2-3-10(11)6-9;3-1-2-4/h4-5,9-11,16H,2-3,6-7H2,1H3;4H,1-3H2/t9-,10+,11-;/m1./s1 |
| InChIKey | OIWZMFRAWARYEC-QJQMQQLTSA-N |
| XLogP | 1.24 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|