About 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid
4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid (PubChem CID 155525342) has the molecular formula C20H15Cl2FN2O4
and a molecular weight of 437.25 g/mol. Its IUPAC name is 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid |
| PubChem CID | 155525342 |
| Molecular Formula | C20H15Cl2FN2O4 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid |
| SMILES | Cn1c(C(=O)NC2(c3ccc(C(=O)O)c(F)c3)COC2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C20H15Cl2FN2O4/c1-25-15-5-4-13(21)17(22)12(15)7-16(25)18(26)24-20(8-29-9-20)10-2-3-11(19(27)28)14(23)6-10/h2-7H,8-9H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | XLDBOXXVXATLAQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid?
The IUPAC name of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid (CID 155525342) is 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid.
What is the SMILES notation for 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid?
The canonical SMILES for 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid is Cn1c(C(=O)NC2(c3ccc(C(=O)O)c(F)c3)COC2)cc2c(Cl)c(Cl)ccc21.
What is the InChIKey of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid?
The InChIKey is XLDBOXXVXATLAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2FN2O4/c1-25-15-5-4-13(21)17(22)12(15)7-16(25)18(26)24-20(8-29-9-20)10-2-3-11(19(27)28)14(23)6-10/h2-7H,8-9H2,1H3,(H,24,26)(H,27,28).
What are the key properties of 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid?
4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid has a molecular weight of 437.25 g/mol, XLogP of 3.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]oxetan-3-yl]-2-fluorobenzoic acid is sourced from PubChem (CID 155525342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).