C27H35B2NO4 — CID 155525430
2,3-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile (PubChem CID 155525430) has the molecular formula C27H35B2NO4 and a molecular weight of 459.20 g/mol. Its IUPAC name is 2,3-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile.
| Compound Name | 2,3-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 155525430 |
| Molecular Formula | C27H35B2NO4 |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2,3-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanenitrile |
| SMILES | CC1(C)OB(c2ccc(CC(C#N)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H35B2NO4/c1-24(2)25(3,4)32-28(31-24)22-13-9-19(10-14-22)17-21(18-30)20-11-15-23(16-12-20)29-33-26(5,6)27(7,8)34-29/h9-16,21H,17H2,1-8H3 |
| InChIKey | MZAAOAJHKMDFEG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|