C19H27BrFN7O7S — CID 155525573
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155525573) has the molecular formula C19H27BrFN7O7S and a molecular weight of 596.44 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155525573 |
| Molecular Formula | C19H27BrFN7O7S |
| Molecular Weight | 596.44 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[5-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S1(=O)N(CCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CCN1CCOCCOCCO |
| InChI | InChI=1S/C19H27BrFN7O7S/c20-15-13-14(1-2-16(15)21)23-19(24-30)17-18(26-35-25-17)22-3-4-27-5-6-28(36(27,31)32)7-9-33-11-12-34-10-8-29/h1-2,13,29-30H,3-12H2,(H,22,26)(H,23,24) |
| InChIKey | IDHKJFACZKAGRG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|