C16H20N4S2 — CID 155525580
1-butyl-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea (PubChem CID 155525580) has the molecular formula C16H20N4S2 and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-butyl-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea.
| Compound Name | 1-butyl-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 155525580 |
| Molecular Formula | C16H20N4S2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-butyl-3-[[3-(2-cyclopropylethynyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]thiourea |
| SMILES | CCCCNC(=S)NCc1cnc2scc(C#CC3CC3)n12 |
| InChI | InChI=1S/C16H20N4S2/c1-2-3-8-17-15(21)18-9-14-10-19-16-20(14)13(11-22-16)7-6-12-4-5-12/h10-12H,2-5,8-9H2,1H3,(H2,17,18,21) |
| InChIKey | LEDNBIWQGAXVFZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|