About CID 155525581
CID 155525581 (PubChem CID 155525581) has the molecular formula C26H29ClN7O4
and a molecular weight of 539.02 g/mol.
Molecular Properties
| Compound Name | CID 155525581 |
| PubChem CID | 155525581 |
| Molecular Formula | C26H29ClN7O4 |
| Molecular Weight | 539.02 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3ncc([N+](=O)[O-])c(Nc4cccc(Cl)c4)n3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C26H29ClN7O4/c1-25(2)13-20(14-26(3,4)34(25)38)30-23(35)16-8-10-18(11-9-16)31-24-28-15-21(33(36)37)22(32-24)29-19-7-5-6-17(27)12-19/h5-12,15,20H,13-14H2,1-4H3,(H,30,35)(H2,28,29,31,32) |
| InChIKey | GXSLNZRYHCTIMQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 145.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.02 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 155525581 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155525581?
The IUPAC name of CID 155525581 (CID 155525581) is not available.
What is the SMILES notation for CID 155525581?
The canonical SMILES for CID 155525581 is CC1(C)CC(NC(=O)c2ccc(Nc3ncc([N+](=O)[O-])c(Nc4cccc(Cl)c4)n3)cc2)CC(C)(C)N1[O].
What is the InChIKey of CID 155525581?
The InChIKey is GXSLNZRYHCTIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29ClN7O4/c1-25(2)13-20(14-26(3,4)34(25)38)30-23(35)16-8-10-18(11-9-16)31-24-28-15-21(33(36)37)22(32-24)29-19-7-5-6-17(27)12-19/h5-12,15,20H,13-14H2,1-4H3,(H,30,35)(H2,28,29,31,32).
What are the key properties of CID 155525581?
CID 155525581 has a molecular weight of 539.02 g/mol, XLogP of 5.62, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155525581 is sourced from PubChem (CID 155525581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).