C24H18FN3O2 — CID 155525776
3-fluoro-5-[[6-(2-methylindazol-6-yl)indol-1-yl]methyl]benzoic acid (PubChem CID 155525776) has the molecular formula C24H18FN3O2 and a molecular weight of 399.43 g/mol. Its IUPAC name is 3-fluoro-5-[[6-(2-methylindazol-6-yl)indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-fluoro-5-[[6-(2-methylindazol-6-yl)indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 155525776 |
| Molecular Formula | C24H18FN3O2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-fluoro-5-[[6-(2-methylindazol-6-yl)indol-1-yl]methyl]benzoic acid |
| SMILES | Cn1cc2ccc(-c3ccc4ccn(Cc5cc(F)cc(C(=O)O)c5)c4c3)cc2n1 |
| InChI | InChI=1S/C24H18FN3O2/c1-27-14-19-5-4-17(11-22(19)26-27)18-3-2-16-6-7-28(23(16)12-18)13-15-8-20(24(29)30)10-21(25)9-15/h2-12,14H,13H2,1H3,(H,29,30) |
| InChIKey | KJOMSRRQHGNDDD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |