About 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one
3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one (PubChem CID 155525804) has the molecular formula C19H21N5O4
and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one.
Molecular Properties
| Compound Name | 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one |
| PubChem CID | 155525804 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one |
| SMILES | COc1ccc(-c2cn3c(=O)c4ncn(CCC(CO)CO)c4nc3[nH]2)cc1 |
| InChI | InChI=1S/C19H21N5O4/c1-28-14-4-2-13(3-5-14)15-8-24-18(27)16-17(22-19(24)21-15)23(11-20-16)7-6-12(9-25)10-26/h2-5,8,11-12,25-26H,6-7,9-10H2,1H3,(H,21,22) |
| InChIKey | ZWEZXXQPQZWJTL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one?
The IUPAC name of 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one (CID 155525804) is 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one.
What is the SMILES notation for 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one?
The canonical SMILES for 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one is COc1ccc(-c2cn3c(=O)c4ncn(CCC(CO)CO)c4nc3[nH]2)cc1.
What is the InChIKey of 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one?
The InChIKey is ZWEZXXQPQZWJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O4/c1-28-14-4-2-13(3-5-14)15-8-24-18(27)16-17(22-19(24)21-15)23(11-20-16)7-6-12(9-25)10-26/h2-5,8,11-12,25-26H,6-7,9-10H2,1H3,(H,21,22).
What are the key properties of 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one?
3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one has a molecular weight of 383.41 g/mol, XLogP of 1.04, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-hydroxy-3-(hydroxymethyl)butyl]-6-(4-methoxyphenyl)-5H-imidazo[1,2-a]purin-9-one is sourced from PubChem (CID 155525804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).