C19H22O3 — CID 155525805
(2S)-2-ethenyl-10-hydroxy-2,8,8-trimethyl-1,5,6,7-tetrahydrophenanthrene-3,9-dione (PubChem CID 155525805) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S)-2-ethenyl-10-hydroxy-2,8,8-trimethyl-1,5,6,7-tetrahydrophenanthrene-3,9-dione.
| Compound Name | (2S)-2-ethenyl-10-hydroxy-2,8,8-trimethyl-1,5,6,7-tetrahydrophenanthrene-3,9-dione |
|---|---|
| PubChem CID | 155525805 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2S)-2-ethenyl-10-hydroxy-2,8,8-trimethyl-1,5,6,7-tetrahydrophenanthrene-3,9-dione |
| SMILES | C=C[C@]1(C)CC2=C(O)C(=O)C3=C(CCCC3(C)C)C2=CC1=O |
| InChI | InChI=1S/C19H22O3/c1-5-19(4)10-13-12(9-14(19)20)11-7-6-8-18(2,3)15(11)17(22)16(13)21/h5,9,21H,1,6-8,10H2,2-4H3/t19-/m1/s1 |
| InChIKey | KQPLUKSSTZDQCK-LJQANCHMSA-N |
| XLogP | 3.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|