C23H19F3N4O — CID 155525856
2-methoxy-4-[(E)-2-[(8S)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]benzonitrile (PubChem CID 155525856) has the molecular formula C23H19F3N4O and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-2-[(8S)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]benzonitrile.
| Compound Name | 2-methoxy-4-[(E)-2-[(8S)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 155525856 |
| Molecular Formula | C23H19F3N4O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-methoxy-4-[(E)-2-[(8S)-8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]benzonitrile |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCC[C@H]3c2ccccc2C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C23H19F3N4O/c1-31-20-13-15(8-10-16(20)14-27)9-11-21-28-22-18(6-4-12-30(22)29-21)17-5-2-3-7-19(17)23(24,25)26/h2-3,5,7-11,13,18H,4,6,12H2,1H3/b11-9+/t18-/m0/s1 |
| InChIKey | PAUIQZYEWVGKRB-CKDFRHGISA-N |
| XLogP | 5.27 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |