C16H22O3 — CID 155525865
(4E,6R,8S,9S)-6-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),4-dien-11-one (PubChem CID 155525865) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4E,6R,8S,9S)-6-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),4-dien-11-one.
| Compound Name | (4E,6R,8S,9S)-6-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),4-dien-11-one |
|---|---|
| PubChem CID | 155525865 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4E,6R,8S,9S)-6-methoxy-5-methyl-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodeca-1(12),4-dien-11-one |
| SMILES | C=C(C)[C@@H]1C[C@@H](OC)/C(C)=C/CCC2=C[C@@H]1OC2=O |
| InChI | InChI=1S/C16H22O3/c1-10(2)13-9-14(18-4)11(3)6-5-7-12-8-15(13)19-16(12)17/h6,8,13-15H,1,5,7,9H2,2-4H3/b11-6+/t13-,14+,15-/m0/s1 |
| InChIKey | AAPJKDZAKRLJMN-MSYXNMSRSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|