C31H31NO9S — CID 155526205
3-[3-[(1R,5S,6R,7S,9S,10S)-3-(4-carboxyphenyl)sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid (PubChem CID 155526205) has the molecular formula C31H31NO9S and a molecular weight of 593.65 g/mol. Its IUPAC name is 3-[3-[(1R,5S,6R,7S,9S,10S)-3-(4-carboxyphenyl)sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid.
| Compound Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-3-(4-carboxyphenyl)sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 155526205 |
| Molecular Formula | C31H31NO9S |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 3-[3-[(1R,5S,6R,7S,9S,10S)-3-(4-carboxyphenyl)sulfanyl-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]propanoylamino]-2,4-dihydroxybenzoic acid |
| SMILES | C[C@]12C[C@@]34C=C(Sc5ccc(C(=O)O)cc5)C(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@@H]3[C@H](C[C@@H]1C4)O2 |
| InChI | InChI=1S/C31H31NO9S/c1-29(10-9-22(34)32-23-19(33)8-7-18(24(23)35)28(39)40)25-20-11-16-12-31(25,14-30(16,2)41-20)13-21(26(29)36)42-17-5-3-15(4-6-17)27(37)38/h3-8,13,16,20,25,33,35H,9-12,14H2,1-2H3,(H,32,34)(H,37,38)(H,39,40)/t16-,20+,25+,29+,30+,31-/m1/s1 |
| InChIKey | CEKVMIDRBKLZDI-LQJIHWANSA-N |
| XLogP | 5.05 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|