C31H38N10O2 — CID 155526236
1-[(3R)-3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 155526236) has the molecular formula C31H38N10O2 and a molecular weight of 582.71 g/mol. Its IUPAC name is 1-[(3R)-3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155526236 |
| Molecular Formula | C31H38N10O2 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 1-[(3R)-3-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](Oc2nc(Nc3ccc(N4CCN(CC)CC4)cc3)nc3[nH]cc(-c4cncc(NC)n4)c23)C1 |
| InChI | InChI=1S/C31H38N10O2/c1-4-27(42)41-12-6-7-23(20-41)43-30-28-24(25-18-33-19-26(32-3)36-25)17-34-29(28)37-31(38-30)35-21-8-10-22(11-9-21)40-15-13-39(5-2)14-16-40/h4,8-11,17-19,23H,1,5-7,12-16,20H2,2-3H3,(H,32,36)(H2,34,35,37,38)/t23-/m1/s1 |
| InChIKey | XPQGFWNRDJTDAQ-HSZRJFAPSA-N |
| XLogP | 3.90 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|