C14H28N4O8 — CID 155526253
ethyl (2S)-2-amino-5-[[amino-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]methylidene]amino]pentanoate (PubChem CID 155526253) has the molecular formula C14H28N4O8 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl (2S)-2-amino-5-[[amino-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]methylidene]amino]pentanoate.
| Compound Name | ethyl (2S)-2-amino-5-[[amino-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 155526253 |
| Molecular Formula | C14H28N4O8 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | ethyl (2S)-2-amino-5-[[amino-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]methylidene]amino]pentanoate |
| SMILES | CCOC(=O)[C@@H](N)CCC/N=C(\N)NO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H28N4O8/c1-2-24-12(23)7(15)4-3-5-17-14(16)18-26-13-11(22)10(21)9(20)8(6-19)25-13/h7-11,13,19-22H,2-6,15H2,1H3,(H3,16,17,18)/t7-,8+,9-,10-,11+,13-/m0/s1 |
| InChIKey | PGUWLGDGSPIEHX-BESPPFRDSA-N |
| XLogP | -3.71 |
| TPSA | 202.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|