C30H38O7S — CID 155526294
[(1R,2R,4aR,5S,6S,8aS)-2-acetyloxy-1,4a-dimethyl-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]spiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methyl acetate (PubChem CID 155526294) has the molecular formula C30H38O7S and a molecular weight of 542.69 g/mol. Its IUPAC name is [(1R,2R,4aR,5S,6S,8aS)-2-acetyloxy-1,4a-dimethyl-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]spiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methyl acetate.
| Compound Name | [(1R,2R,4aR,5S,6S,8aS)-2-acetyloxy-1,4a-dimethyl-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]spiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methyl acetate |
|---|---|
| PubChem CID | 155526294 |
| Molecular Formula | C30H38O7S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | [(1R,2R,4aR,5S,6S,8aS)-2-acetyloxy-1,4a-dimethyl-5-[2-(5-oxo-2H-furan-4-yl)-2-phenylsulfanylethyl]spiro[3,4,5,7,8,8a-hexahydro-2H-naphthalene-6,2'-oxirane]-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@H]2CC[C@@]3(CO3)[C@@H](CC(Sc3ccccc3)C3=CCOC3=O)[C@]2(C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H38O7S/c1-19(31)35-17-29(4)24-10-14-30(18-36-30)25(28(24,3)13-11-26(29)37-20(2)32)16-23(22-12-15-34-27(22)33)38-21-8-6-5-7-9-21/h5-9,12,23-26H,10-11,13-18H2,1-4H3/t23?,24-,25-,26+,28+,29-,30+/m0/s1 |
| InChIKey | BJMAYYVMYJSQEM-DYBYRJLESA-N |
| XLogP | 5.12 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|