C38H23F4N9O — CID 155526320
6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,4-N-bis(2-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 155526320) has the molecular formula C38H23F4N9O and a molecular weight of 697.66 g/mol. Its IUPAC name is 6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,4-N-bis(2-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,4-N-bis(2-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155526320 |
| Molecular Formula | C38H23F4N9O |
| Molecular Weight | 697.66 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | 6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,4-N-bis(2-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1ccc(-c2nc(-c3cccc(-n4cc(-c5nc(Nc6ccccc6F)nc(Nc6ccccc6F)n5)nn4)c3)oc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C38H23F4N9O/c39-25-16-12-22(13-17-25)33-34(23-14-18-26(40)19-15-23)52-36(45-33)24-6-5-7-27(20-24)51-21-32(49-50-51)35-46-37(43-30-10-3-1-8-28(30)41)48-38(47-35)44-31-11-4-2-9-29(31)42/h1-21H,(H2,43,44,46,47,48) |
| InChIKey | CYMDGQVQSFQHOZ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.66 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |