C27H30O8 — CID 155526351
[(7S)-7-methyl-3-(2-methyl-6-oxocyclohexen-1-yl)-6,8-dioxoisochromen-7-yl] (E,2S,3R)-3-acetyloxy-2,4-dimethylhex-4-enoate (PubChem CID 155526351) has the molecular formula C27H30O8 and a molecular weight of 482.53 g/mol. Its IUPAC name is [(7S)-7-methyl-3-(2-methyl-6-oxocyclohexen-1-yl)-6,8-dioxoisochromen-7-yl] (E,2S,3R)-3-acetyloxy-2,4-dimethylhex-4-enoate.
| Compound Name | [(7S)-7-methyl-3-(2-methyl-6-oxocyclohexen-1-yl)-6,8-dioxoisochromen-7-yl] (E,2S,3R)-3-acetyloxy-2,4-dimethylhex-4-enoate |
|---|---|
| PubChem CID | 155526351 |
| Molecular Formula | C27H30O8 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(7S)-7-methyl-3-(2-methyl-6-oxocyclohexen-1-yl)-6,8-dioxoisochromen-7-yl] (E,2S,3R)-3-acetyloxy-2,4-dimethylhex-4-enoate |
| SMILES | C/C=C(\C)[C@H](OC(C)=O)[C@H](C)C(=O)O[C@@]1(C)C(=O)C=C2C=C(C3=C(C)CCCC3=O)OC=C2C1=O |
| InChI | InChI=1S/C27H30O8/c1-7-14(2)24(34-17(5)28)16(4)26(32)35-27(6)22(30)12-18-11-21(33-13-19(18)25(27)31)23-15(3)9-8-10-20(23)29/h7,11-13,16,24H,8-10H2,1-6H3/b14-7+/t16-,24-,27-/m0/s1 |
| InChIKey | XYLYGSLMKLFYOS-DOZLGCNXSA-N |
| XLogP | 3.77 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|