C12H14IN5O2 — CID 155526367
(1R,2S,3R,4S,5S)-4-amino-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155526367) has the molecular formula C12H14IN5O2 and a molecular weight of 387.18 g/mol. Its IUPAC name is (1R,2S,3R,4S,5S)-4-amino-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2S,3R,4S,5S)-4-amino-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155526367 |
| Molecular Formula | C12H14IN5O2 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | (1R,2S,3R,4S,5S)-4-amino-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1ncnc2c1c(I)cn2[C@]12C[C@H]1[C@H](N)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C12H14IN5O2/c13-5-2-18(11-6(5)10(15)16-3-17-11)12-1-4(12)7(14)8(19)9(12)20/h2-4,7-9,19-20H,1,14H2,(H2,15,16,17)/t4-,7-,8+,9+,12+/m0/s1 |
| InChIKey | HOMYCFIXZDWAGO-NVJYAXLPSA-N |
| XLogP | -0.60 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|