C15H22O3 — CID 155526379
(1R,2S,4S,5S)-1,4-dihydroxy-4-methyl-6-methylidene-2-(2-methylprop-1-enyl)bicyclo[3.3.1]nonan-3-one (PubChem CID 155526379) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2S,4S,5S)-1,4-dihydroxy-4-methyl-6-methylidene-2-(2-methylprop-1-enyl)bicyclo[3.3.1]nonan-3-one.
| Compound Name | (1R,2S,4S,5S)-1,4-dihydroxy-4-methyl-6-methylidene-2-(2-methylprop-1-enyl)bicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 155526379 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2S,4S,5S)-1,4-dihydroxy-4-methyl-6-methylidene-2-(2-methylprop-1-enyl)bicyclo[3.3.1]nonan-3-one |
| SMILES | C=C1CC[C@@]2(O)C[C@@H]1[C@](C)(O)C(=O)[C@H]2C=C(C)C |
| InChI | InChI=1S/C15H22O3/c1-9(2)7-11-13(16)14(4,17)12-8-15(11,18)6-5-10(12)3/h7,11-12,17-18H,3,5-6,8H2,1-2,4H3/t11-,12+,14+,15-/m1/s1 |
| InChIKey | WDQWJAUHOXOJKS-PAPYEOQZSA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|