About ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate
ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate (PubChem CID 155526386) has the molecular formula C21H20O7
and a molecular weight of 384.38 g/mol. Its IUPAC name is ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate.
Molecular Properties
| Compound Name | ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate |
| PubChem CID | 155526386 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C21H20O7/c1-5-27-20(26)21(3,4)28-11-8-13-17(15(23)9-11)19(25)16-12(18(13)24)6-10(2)7-14(16)22/h6-9,22-23H,5H2,1-4H3 |
| InChIKey | CXOQEHYEVVEOLV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate?
The IUPAC name of ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate (CID 155526386) is ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate.
What is the SMILES notation for ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate?
The canonical SMILES for ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate is CCOC(=O)C(C)(C)Oc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O.
What is the InChIKey of ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate?
The InChIKey is CXOQEHYEVVEOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O7/c1-5-27-20(26)21(3,4)28-11-8-13-17(15(23)9-11)19(25)16-12(18(13)24)6-10(2)7-14(16)22/h6-9,22-23H,5H2,1-4H3.
What are the key properties of ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate?
ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate has a molecular weight of 384.38 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl)oxy-2-methylpropanoate is sourced from PubChem (CID 155526386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).