C24H22ClN5O — CID 155526440
2-[(4-chlorophenyl)methoxy]-4-[(5-phenyl-1H-imidazol-2-yl)methylamino]benzenecarboximidamide (PubChem CID 155526440) has the molecular formula C24H22ClN5O and a molecular weight of 431.93 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methoxy]-4-[(5-phenyl-1H-imidazol-2-yl)methylamino]benzenecarboximidamide.
| Compound Name | 2-[(4-chlorophenyl)methoxy]-4-[(5-phenyl-1H-imidazol-2-yl)methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 155526440 |
| Molecular Formula | C24H22ClN5O |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[(4-chlorophenyl)methoxy]-4-[(5-phenyl-1H-imidazol-2-yl)methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2ncc(-c3ccccc3)[nH]2)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN5O/c25-18-8-6-16(7-9-18)15-31-22-12-19(10-11-20(22)24(26)27)28-14-23-29-13-21(30-23)17-4-2-1-3-5-17/h1-13,28H,14-15H2,(H3,26,27)(H,29,30) |
| InChIKey | WEZOBFYTYOBXPI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|