C18H16N4OS — CID 155526466
N-[(3-methoxyphenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine (PubChem CID 155526466) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine.
| Compound Name | N-[(3-methoxyphenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 155526466 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-9-thia-3,5,11-triazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
| SMILES | COc1cccc(CNc2ncc3c(n2)-c2cccnc2SC3)c1 |
| InChI | InChI=1S/C18H16N4OS/c1-23-14-5-2-4-12(8-14)9-20-18-21-10-13-11-24-17-15(16(13)22-18)6-3-7-19-17/h2-8,10H,9,11H2,1H3,(H,20,21,22) |
| InChIKey | DDJFSRMCZAVCPN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |