C29H31N5O2 — CID 155526539
(12aS)-N-(1H-indazol-5-yl)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide (PubChem CID 155526539) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (12aS)-N-(1H-indazol-5-yl)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide.
| Compound Name | (12aS)-N-(1H-indazol-5-yl)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 155526539 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (12aS)-N-(1H-indazol-5-yl)-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide |
| SMILES | COc1cc2c(cc1C(=O)Nc1ccc3[nH]ncc3c1)CCC1C(C)(C)c3nc(C)ncc3C[C@]21C |
| InChI | InChI=1S/C29H31N5O2/c1-16-30-14-19-13-29(4)22-12-24(36-5)21(11-17(22)6-9-25(29)28(2,3)26(19)32-16)27(35)33-20-7-8-23-18(10-20)15-31-34-23/h7-8,10-12,14-15,25H,6,9,13H2,1-5H3,(H,31,34)(H,33,35)/t25?,29-/m1/s1 |
| InChIKey | ZYXWKRVHIXQMFV-SNSSHHSLSA-N |
| XLogP | 5.28 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |