C20H26O3 — CID 155526757
(3S,10Z)-9-hydroxy-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),5,10-triene-4,13-dione (PubChem CID 155526757) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3S,10Z)-9-hydroxy-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),5,10-triene-4,13-dione.
| Compound Name | (3S,10Z)-9-hydroxy-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),5,10-triene-4,13-dione |
|---|---|
| PubChem CID | 155526757 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3S,10Z)-9-hydroxy-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),5,10-triene-4,13-dione |
| SMILES | CC1=C2C[C@]3(C)C(=O)C=C(C(C)C)C3CC(O)/C(C)=C\2CC1=O |
| InChI | InChI=1S/C20H26O3/c1-10(2)13-7-19(23)20(5)9-15-12(4)17(21)6-14(15)11(3)18(22)8-16(13)20/h7,10,16,18,22H,6,8-9H2,1-5H3/b14-11-/t16?,18?,20-/m0/s1 |
| InChIKey | GQVDVKQNOOOQPP-PBDLSTNISA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |