C31H39NO6S — CID 155526842
[(8R,9S,13S,14S,17R)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155526842) has the molecular formula C31H39NO6S and a molecular weight of 553.72 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17R)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155526842 |
| Molecular Formula | C31H39NO6S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-17-[(2E)-2-ethoxy-2-(4-methylphenyl)sulfonyliminoethyl]-17-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCO/C(C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OC(C)=O)ccc4[C@H]3CC[C@@]21C)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H39NO6S/c1-5-37-29(32-39(35,36)24-10-6-20(2)7-11-24)19-31(34)17-15-28-27-12-8-22-18-23(38-21(3)33)9-13-25(22)26(27)14-16-30(28,31)4/h6-7,9-11,13,18,26-28,34H,5,8,12,14-17,19H2,1-4H3/b32-29+/t26-,27-,28+,30+,31-/m1/s1 |
| InChIKey | UYTCBHJFUFJKJF-QYPWMEDMSA-N |
| XLogP | 5.72 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|