About (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride
(2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride (PubChem CID 155526969) has the molecular formula C13H20ClNO2
and a molecular weight of 257.76 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride.
Molecular Properties
| Compound Name | (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride |
| PubChem CID | 155526969 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride |
| SMILES | Cc1ccc(C(C)C)cc1OC(=O)CCN.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-9(2)11-5-4-10(3)12(8-11)16-13(15)6-7-14;/h4-5,8-9H,6-7,14H2,1-3H3;1H |
| InChIKey | STJJKLDIHHFKAT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride?
The IUPAC name of (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride (CID 155526969) is (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride.
What is the SMILES notation for (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride?
The canonical SMILES for (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride is Cc1ccc(C(C)C)cc1OC(=O)CCN.Cl.
What is the InChIKey of (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride?
The InChIKey is STJJKLDIHHFKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.ClH/c1-9(2)11-5-4-10(3)12(8-11)16-13(15)6-7-14;/h4-5,8-9H,6-7,14H2,1-3H3;1H.
What are the key properties of (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride?
(2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride has a molecular weight of 257.76 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-propan-2-ylphenyl) 3-aminopropanoate;hydrochloride is sourced from PubChem (CID 155526969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).