About (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine
(3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine (PubChem CID 155526977) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine.
Molecular Properties
| Compound Name | (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine |
| PubChem CID | 155526977 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine |
| SMILES | CC[C@H]1c2cc(OC)ccc2OC[C@@]1(C)N |
| InChI | InChI=1S/C13H19NO2/c1-4-11-10-7-9(15-3)5-6-12(10)16-8-13(11,2)14/h5-7,11H,4,8,14H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | QTKHCKFFZZANPG-WCQYABFASA-N |
| XLogP | 2.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine?
The IUPAC name of (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine (CID 155526977) is (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine.
What is the SMILES notation for (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine?
The canonical SMILES for (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine is CC[C@H]1c2cc(OC)ccc2OC[C@@]1(C)N.
What is the InChIKey of (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine?
The InChIKey is QTKHCKFFZZANPG-WCQYABFASA-N. The full InChI is InChI=1S/C13H19NO2/c1-4-11-10-7-9(15-3)5-6-12(10)16-8-13(11,2)14/h5-7,11H,4,8,14H2,1-3H3/t11-,13+/m0/s1.
What are the key properties of (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine?
(3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine has a molecular weight of 221.30 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-ethyl-6-methoxy-3-methyl-2,4-dihydrochromen-3-amine is sourced from PubChem (CID 155526977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).