C30H30F7NO5S — CID 155526989
4-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 155526989) has the molecular formula C30H30F7NO5S and a molecular weight of 649.63 g/mol. Its IUPAC name is 4-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155526989 |
| Molecular Formula | C30H30F7NO5S |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | 4-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(S(=O)(=O)[C@@]23CCN(C(=O)C4CCC(C(=O)O)CC4)[C@@H]2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)c1 |
| InChI | InChI=1S/C30H30F7NO5S/c1-17-3-2-4-22(15-17)44(42,43)27-13-14-38(25(39)18-5-7-19(8-6-18)26(40)41)24(27)12-9-20-16-21(10-11-23(20)27)28(31,29(32,33)34)30(35,36)37/h2-4,10-11,15-16,18-19,24H,5-9,12-14H2,1H3,(H,40,41)/t18?,19?,24-,27-/m1/s1 |
| InChIKey | UCLOLQONKUCIPI-BIPNSPSSSA-N |
| XLogP | 6.39 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |