C15H14ClN7O3S — CID 155527018
1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-chlorophenyl)urea (PubChem CID 155527018) has the molecular formula C15H14ClN7O3S and a molecular weight of 407.84 g/mol. Its IUPAC name is 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 155527018 |
| Molecular Formula | C15H14ClN7O3S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-(4-chlorophenyl)urea |
| SMILES | Nc1nc(NC(=O)Nc2ccc(Cl)cc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14ClN7O3S/c16-9-1-3-10(4-2-9)19-15(24)21-14-20-13(17)23(22-14)11-5-7-12(8-6-11)27(18,25)26/h1-8H,(H2,18,25,26)(H4,17,19,20,21,22,24) |
| InChIKey | JQYMIYBUMXAHTA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |