About 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one
6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one (PubChem CID 155527059) has the molecular formula C16H13FN2O2
and a molecular weight of 284.29 g/mol. Its IUPAC name is 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one |
| PubChem CID | 155527059 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one |
| SMILES | Cc1cc(-c2nc3ccc(F)cc3c(=O)[nH]2)cc(C)c1O |
| InChI | InChI=1S/C16H13FN2O2/c1-8-5-10(6-9(2)14(8)20)15-18-13-4-3-11(17)7-12(13)16(21)19-15/h3-7,20H,1-2H3,(H,18,19,21) |
| InChIKey | YUUVWHXJRBBQES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
The IUPAC name of 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one (CID 155527059) is 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one.
What is the SMILES notation for 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
The canonical SMILES for 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one is Cc1cc(-c2nc3ccc(F)cc3c(=O)[nH]2)cc(C)c1O.
What is the InChIKey of 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
The InChIKey is YUUVWHXJRBBQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O2/c1-8-5-10(6-9(2)14(8)20)15-18-13-4-3-11(17)7-12(13)16(21)19-15/h3-7,20H,1-2H3,(H,18,19,21).
What are the key properties of 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one?
6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one has a molecular weight of 284.29 g/mol, XLogP of 3.05, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-(4-hydroxy-3,5-dimethylphenyl)-3H-quinazolin-4-one is sourced from PubChem (CID 155527059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).