C21H20N8 — CID 155527094
7-(2-piperazin-1-ylpyrimidin-5-yl)-N-pyrazin-2-ylquinolin-4-amine (PubChem CID 155527094) has the molecular formula C21H20N8 and a molecular weight of 384.45 g/mol. Its IUPAC name is 7-(2-piperazin-1-ylpyrimidin-5-yl)-N-pyrazin-2-ylquinolin-4-amine.
| Compound Name | 7-(2-piperazin-1-ylpyrimidin-5-yl)-N-pyrazin-2-ylquinolin-4-amine |
|---|---|
| PubChem CID | 155527094 |
| Molecular Formula | C21H20N8 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 7-(2-piperazin-1-ylpyrimidin-5-yl)-N-pyrazin-2-ylquinolin-4-amine |
| SMILES | c1cnc(Nc2ccnc3cc(-c4cnc(N5CCNCC5)nc4)ccc23)cn1 |
| InChI | InChI=1S/C21H20N8/c1-2-17-18(28-20-14-23-5-6-25-20)3-4-24-19(17)11-15(1)16-12-26-21(27-13-16)29-9-7-22-8-10-29/h1-6,11-14,22H,7-10H2,(H,24,25,28) |
| InChIKey | JDMRWHRTEFZEIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |