C16H14N8O5S — CID 155527153
5-amino-N-[(E)-(4-nitrophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155527153) has the molecular formula C16H14N8O5S and a molecular weight of 430.41 g/mol. Its IUPAC name is 5-amino-N-[(E)-(4-nitrophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-amino-N-[(E)-(4-nitrophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155527153 |
| Molecular Formula | C16H14N8O5S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 5-amino-N-[(E)-(4-nitrophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Nc1nc(C(=O)N/N=C/c2ccc([N+](=O)[O-])cc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H14N8O5S/c17-16-20-14(22-23(16)11-5-7-13(8-6-11)30(18,28)29)15(25)21-19-9-10-1-3-12(4-2-10)24(26)27/h1-9H,(H,21,25)(H2,17,20,22)(H2,18,28,29)/b19-9+ |
| InChIKey | WXZWNCCNUXGJEF-DJKKODMXSA-N |
| XLogP | 0.17 |
| TPSA | 201.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|