C19H16ClN3OS — CID 155527206
6-chloro-2-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazole (PubChem CID 155527206) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 6-chloro-2-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazole.
| Compound Name | 6-chloro-2-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 155527206 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 6-chloro-2-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1,3-benzothiazole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(c1nc2ccc(Cl)cc2s1)C3 |
| InChI | InChI=1S/C19H16ClN3OS/c1-24-12-3-5-15-14(9-12)13-6-7-23(10-17(13)21-15)19-22-16-4-2-11(20)8-18(16)25-19/h2-5,8-9,21H,6-7,10H2,1H3 |
| InChIKey | FXNNDZZJCURNQL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|