C20H22N8O4S — CID 155527209
5-amino-N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155527209) has the molecular formula C20H22N8O4S and a molecular weight of 470.52 g/mol. Its IUPAC name is 5-amino-N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-amino-N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155527209 |
| Molecular Formula | C20H22N8O4S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 5-amino-N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Nc1nc(C(=O)N/N=C/c2ccc(N3CCOCC3)cc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H22N8O4S/c21-20-24-18(26-28(20)16-5-7-17(8-6-16)33(22,30)31)19(29)25-23-13-14-1-3-15(4-2-14)27-9-11-32-12-10-27/h1-8,13H,9-12H2,(H,25,29)(H2,21,24,26)(H2,22,30,31)/b23-13+ |
| InChIKey | RTBGSWGBOGCQBV-YDZHTSKRSA-N |
| XLogP | 0.10 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|