C19H19N3O2S2 — CID 155527234
1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 155527234) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 155527234 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 1-(1-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(c1ccccc1)N1CCc2cc(S(=O)(=O)Nc3nccs3)ccc21 |
| InChI | InChI=1S/C19H19N3O2S2/c1-14(15-5-3-2-4-6-15)22-11-9-16-13-17(7-8-18(16)22)26(23,24)21-19-20-10-12-25-19/h2-8,10,12-14H,9,11H2,1H3,(H,20,21) |
| InChIKey | SVHFOHFXYDMAPK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |