C15H24O2 — CID 155527301
(1R,2R,7S,8aR)-7-(3-hydroxyprop-1-en-2-yl)-1,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 155527301) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2R,7S,8aR)-7-(3-hydroxyprop-1-en-2-yl)-1,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,7S,8aR)-7-(3-hydroxyprop-1-en-2-yl)-1,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 155527301 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2R,7S,8aR)-7-(3-hydroxyprop-1-en-2-yl)-1,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | C=C(CO)[C@H]1CC=C2CC[C@@H](O)[C@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C15H24O2/c1-10(9-16)12-4-5-13-6-7-14(17)11(2)15(13,3)8-12/h5,11-12,14,16-17H,1,4,6-9H2,2-3H3/t11-,12-,14+,15+/m0/s1 |
| InChIKey | VDLDBDDHAKELKL-DDHJSBNISA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|