C13H27NO3 — CID 155527378
(2R,3R,4R,5R)-2-octylpiperidine-3,4,5-triol (PubChem CID 155527378) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-octylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R)-2-octylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155527378 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | (2R,3R,4R,5R)-2-octylpiperidine-3,4,5-triol |
| SMILES | CCCCCCCC[C@H]1NC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H27NO3/c1-2-3-4-5-6-7-8-10-12(16)13(17)11(15)9-14-10/h10-17H,2-9H2,1H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | MGETUKQLQDZANV-FDYHWXHSSA-N |
| XLogP | 0.79 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|