C30H37NO4S — CID 155527486
ethyl (1E)-2-[(8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate (PubChem CID 155527486) has the molecular formula C30H37NO4S and a molecular weight of 507.70 g/mol. Its IUPAC name is ethyl (1E)-2-[(8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate.
| Compound Name | ethyl (1E)-2-[(8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate |
|---|---|
| PubChem CID | 155527486 |
| Molecular Formula | C30H37NO4S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | ethyl (1E)-2-[(8S,9S,13S,14S)-3-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate |
| SMILES | CCO/C(CC1=CC[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@]12C)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H37NO4S/c1-5-35-29(31-36(32,33)24-11-6-20(2)7-12-24)19-22-9-15-28-27-13-8-21-18-23(34-4)10-14-25(21)26(27)16-17-30(22,28)3/h6-7,9-12,14,18,26-28H,5,8,13,15-17,19H2,1-4H3/b31-29+/t26-,27-,28+,30-/m1/s1 |
| InChIKey | KVGPOCWARLDGOS-OVHARFGLSA-N |
| XLogP | 6.61 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|