C21H27NO6 — CID 155527535
(2R,3S)-6-(hexylamino)-2,3,5,8-tetrahydroxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione (PubChem CID 155527535) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (2R,3S)-6-(hexylamino)-2,3,5,8-tetrahydroxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione.
| Compound Name | (2R,3S)-6-(hexylamino)-2,3,5,8-tetrahydroxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione |
|---|---|
| PubChem CID | 155527535 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2R,3S)-6-(hexylamino)-2,3,5,8-tetrahydroxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione |
| SMILES | CCCCCCNc1cc(O)c2c(c1O)C(=O)C1=C(C[C@@H](O)[C@@](C)(O)C1)C2=O |
| InChI | InChI=1S/C21H27NO6/c1-3-4-5-6-7-22-13-9-14(23)16-17(20(13)27)19(26)12-10-21(2,28)15(24)8-11(12)18(16)25/h9,15,22-24,27-28H,3-8,10H2,1-2H3/t15-,21+/m1/s1 |
| InChIKey | PZLWEKXJXPTPQO-VFNWGFHPSA-N |
| XLogP | 2.67 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|