C26H44O7 — CID 155527593
(2R,3R,4S,5S,6R)-2-[(E,2S)-1-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-hydroxy-3-methylpent-3-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 155527593) has the molecular formula C26H44O7 and a molecular weight of 468.63 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(E,2S)-1-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-hydroxy-3-methylpent-3-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(E,2S)-1-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-hydroxy-3-methylpent-3-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155527593 |
| Molecular Formula | C26H44O7 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(E,2S)-1-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-5-hydroxy-3-methylpent-3-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)/C(C)=C/CO |
| InChI | InChI=1S/C26H44O7/c1-15-7-8-20-25(3,4)10-6-11-26(20,5)17(15)13-18(16(2)9-12-27)32-24-23(31)22(30)21(29)19(14-28)33-24/h9,17-24,27-31H,1,6-8,10-14H2,2-5H3/b16-9+/t17-,18-,19+,20-,21+,22-,23+,24+,26+/m0/s1 |
| InChIKey | XTDDCCRQJUDZTC-RLWRPSECSA-N |
| XLogP | 2.30 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|