C10H10N2O4 — CID 155527596
2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylic acid (PubChem CID 155527596) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylic acid.
| Compound Name | 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylic acid |
|---|---|
| PubChem CID | 155527596 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylic acid |
| SMILES | CC1(C)[N+]([O-])=c2ccc(C(=O)O)cc2=[N+]1[O-] |
| InChI | InChI=1S/C10H10N2O4/c1-10(2)11(15)7-4-3-6(9(13)14)5-8(7)12(10)16/h3-5H,1-2H3,(H,13,14) |
| InChIKey | TZOUXBONWAANCX-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|