C20H14N4O2S — CID 155527607
3-[6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one (PubChem CID 155527607) has the molecular formula C20H14N4O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-[6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one.
| Compound Name | 3-[6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 155527607 |
| Molecular Formula | C20H14N4O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]chromen-2-one |
| SMILES | Cc1ccc(C2=Nn3c(nnc3-c3cc4ccccc4oc3=O)SC2)cc1 |
| InChI | InChI=1S/C20H14N4O2S/c1-12-6-8-13(9-7-12)16-11-27-20-22-21-18(24(20)23-16)15-10-14-4-2-3-5-17(14)26-19(15)25/h2-10H,11H2,1H3 |
| InChIKey | XPNRDBHJJPZTDK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|