C25H21N3O2S — CID 155527612
12-methoxy-3-(4-methoxyphenyl)-5-thiophen-2-yl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene (PubChem CID 155527612) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 12-methoxy-3-(4-methoxyphenyl)-5-thiophen-2-yl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene.
| Compound Name | 12-methoxy-3-(4-methoxyphenyl)-5-thiophen-2-yl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 155527612 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 12-methoxy-3-(4-methoxyphenyl)-5-thiophen-2-yl-4,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaene |
| SMILES | COc1ccc(-c2nc(-c3cccs3)n3c2-c2[nH]c4ccc(OC)cc4c2CC3)cc1 |
| InChI | InChI=1S/C25H21N3O2S/c1-29-16-7-5-15(6-8-16)22-24-23-18(19-14-17(30-2)9-10-20(19)26-23)11-12-28(24)25(27-22)21-4-3-13-31-21/h3-10,13-14,26H,11-12H2,1-2H3 |
| InChIKey | QTVLACSCCOWUBI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|