About N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide
N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide (PubChem CID 155527650) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide |
| PubChem CID | 155527650 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide |
| SMILES | CNc1cc(NC(C)=O)nc(-c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C16H19N3O/c1-10-6-5-7-14(11(10)2)15-8-13(17-4)9-16(19-15)18-12(3)20/h5-9H,1-4H3,(H2,17,18,19,20) |
| InChIKey | BOOFLAUEYOEJMP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide?
The IUPAC name of N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide (CID 155527650) is N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide.
What is the SMILES notation for N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide?
The canonical SMILES for N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide is CNc1cc(NC(C)=O)nc(-c2cccc(C)c2C)c1.
What is the InChIKey of N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide?
The InChIKey is BOOFLAUEYOEJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O/c1-10-6-5-7-14(11(10)2)15-8-13(17-4)9-16(19-15)18-12(3)20/h5-9H,1-4H3,(H2,17,18,19,20).
What are the key properties of N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide?
N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide has a molecular weight of 269.35 g/mol, XLogP of 3.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-dimethylphenyl)-4-(methylamino)-2-pyridinyl]acetamide is sourced from PubChem (CID 155527650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).