About 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine
10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine (PubChem CID 155527739) has the molecular formula C34H44N2O2
and a molecular weight of 512.74 g/mol. Its IUPAC name is 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine.
Molecular Properties
| Compound Name | 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine |
| PubChem CID | 155527739 |
| Molecular Formula | C34H44N2O2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCN2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C34H44N2O2/c1-2-3-4-5-6-7-13-27-18-20-28(21-19-27)29-22-23-35-30(29)26-37-25-12-24-36-31-14-8-10-16-33(31)38-34-17-11-9-15-32(34)36/h8-11,14-21,29-30,35H,2-7,12-13,22-26H2,1H3/t29-,30-/m1/s1 |
| InChIKey | KSXYKTHCUNBQOG-LOYHVIPDSA-N |
| XLogP | 8.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine?
The IUPAC name of 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine (CID 155527739) is 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine.
What is the SMILES notation for 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine?
The canonical SMILES for 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine is CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCN2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine?
The InChIKey is KSXYKTHCUNBQOG-LOYHVIPDSA-N. The full InChI is InChI=1S/C34H44N2O2/c1-2-3-4-5-6-7-13-27-18-20-28(21-19-27)29-22-23-35-30(29)26-37-25-12-24-36-31-14-8-10-16-33(31)38-34-17-11-9-15-32(34)36/h8-11,14-21,29-30,35H,2-7,12-13,22-26H2,1H3/t29-,30-/m1/s1.
What are the key properties of 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine?
10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine has a molecular weight of 512.74 g/mol, XLogP of 8.39, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine is sourced from PubChem (CID 155527739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).