C34H44N2O2 — CID 155527739
10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine (PubChem CID 155527739) has the molecular formula C34H44N2O2 and a molecular weight of 512.74 g/mol. Its IUPAC name is 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine.
| Compound Name | 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine |
|---|---|
| PubChem CID | 155527739 |
| Molecular Formula | C34H44N2O2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 10-[3-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]propyl]phenoxazine |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCN2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C34H44N2O2/c1-2-3-4-5-6-7-13-27-18-20-28(21-19-27)29-22-23-35-30(29)26-37-25-12-24-36-31-14-8-10-16-33(31)38-34-17-11-9-15-32(34)36/h8-11,14-21,29-30,35H,2-7,12-13,22-26H2,1H3/t29-,30-/m1/s1 |
| InChIKey | KSXYKTHCUNBQOG-LOYHVIPDSA-N |
| XLogP | 8.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|