C34H33F2N9O — CID 155527779
6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine (PubChem CID 155527779) has the molecular formula C34H33F2N9O and a molecular weight of 621.70 g/mol. Its IUPAC name is 6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155527779 |
| Molecular Formula | C34H33F2N9O |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | 6-[1-[3-[4,5-bis(4-fluorophenyl)-1,3-oxazol-2-yl]phenyl]triazol-4-yl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(-c2cn(-c3cccc(-c4nc(-c5ccc(F)cc5)c(-c5ccc(F)cc5)o4)c3)nn2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C34H33F2N9O/c1-5-43(6-2)33-38-31(39-34(40-33)44(7-3)8-4)28-21-45(42-41-28)27-11-9-10-24(20-27)32-37-29(22-12-16-25(35)17-13-22)30(46-32)23-14-18-26(36)19-15-23/h9-21H,5-8H2,1-4H3 |
| InChIKey | GYDICTRXZXKQKN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 101.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |