C15H14N6S — CID 155527835
10-phenyl-7-propyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione (PubChem CID 155527835) has the molecular formula C15H14N6S and a molecular weight of 310.39 g/mol. Its IUPAC name is 10-phenyl-7-propyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione.
| Compound Name | 10-phenyl-7-propyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione |
|---|---|
| PubChem CID | 155527835 |
| Molecular Formula | C15H14N6S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 10-phenyl-7-propyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-5-thione |
| SMILES | CCCc1nc2c(cnn2-c2ccccc2)c2n[nH]c(=S)n12 |
| InChI | InChI=1S/C15H14N6S/c1-2-6-12-17-13-11(14-18-19-15(22)20(12)14)9-16-21(13)10-7-4-3-5-8-10/h3-5,7-9H,2,6H2,1H3,(H,19,22) |
| InChIKey | HILKPCGGLQPFLR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|