C25H35N7O2 — CID 155527869
4-[[9-cyclopentyl-6-[3-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]butan-1-ol (PubChem CID 155527869) has the molecular formula C25H35N7O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 4-[[9-cyclopentyl-6-[3-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[9-cyclopentyl-6-[3-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 155527869 |
| Molecular Formula | C25H35N7O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 4-[[9-cyclopentyl-6-[3-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]butan-1-ol |
| SMILES | OCCCCNc1nc(Nc2cccc(CN3CCOCC3)c2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C25H35N7O2/c33-13-4-3-10-26-25-29-23(22-24(30-25)32(18-27-22)21-8-1-2-9-21)28-20-7-5-6-19(16-20)17-31-11-14-34-15-12-31/h5-7,16,18,21,33H,1-4,8-15,17H2,(H2,26,28,29,30) |
| InChIKey | KUOUBJAAAVPRED-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|